C40H64N8O6Si2 — CID 157278114
methyl 4-(7-aminopyrazolo[1,5-a]pyrimidin-5-yl)cyclohexane-1-carboxylate;methyl 4-[7-[bis(2-trimethylsilylethoxymethyl)amino]pyrazolo[1,5-a]pyrimidin-5-yl]cyclohexane-1-carboxylate (PubChem CID 157278114) has the molecular formula C40H64N8O6Si2 and a molecular weight of 809.17 g/mol. Its IUPAC name is methyl 4-(7-aminopyrazolo[1,5-a]pyrimidin-5-yl)cyclohexane-1-carboxylate;methyl 4-[7-[bis(2-trimethylsilylethoxymethyl)amino]pyrazolo[1,5-a]pyrimidin-5-yl]cyclohexane-1-carboxylate.
| Compound Name | methyl 4-(7-aminopyrazolo[1,5-a]pyrimidin-5-yl)cyclohexane-1-carboxylate;methyl 4-[7-[bis(2-trimethylsilylethoxymethyl)amino]pyrazolo[1,5-a]pyrimidin-5-yl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 157278114 |
| Molecular Formula | C40H64N8O6Si2 |
| Molecular Weight | 809.17 g/mol |
| Exact Mass | 808.45 |
| IUPAC Name | methyl 4-(7-aminopyrazolo[1,5-a]pyrimidin-5-yl)cyclohexane-1-carboxylate;methyl 4-[7-[bis(2-trimethylsilylethoxymethyl)amino]pyrazolo[1,5-a]pyrimidin-5-yl]cyclohexane-1-carboxylate |
| SMILES | COC(=O)C1CCC(c2cc(N(COCC[Si](C)(C)C)COCC[Si](C)(C)C)n3nccc3n2)CC1.COC(=O)C1CCC(c2cc(N)n3nccc3n2)CC1 |
| InChI | InChI=1S/C26H46N4O4Si2.C14H18N4O2/c1-32-26(31)22-10-8-21(9-11-22)23-18-25(30-24(28-23)12-13-27-30)29(19-33-14-16-35(2,3)4)20-34-15-17-36(5,6)7;1-20-14(19)10-4-2-9(3-5-10)11-8-12(15)18-13(17-11)6-7-16-18/h12-13,18,21-22H,8-11,14-17,19-20H2,1-7H3;6-10H,2-5,15H2,1H3 |
| InChIKey | AZIMMBCJRYZWAP-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 160.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 809.17 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|