C31H36N6O12 — CID 157278961
3-[[4-[[5-(2-methylcyclopropyl)pyrazol-1-yl]methyl]phenyl]methyl]-1,7,13,19-tetraoxa-4,10,16,22-tetrazacyclotetracosane-2,5,8,11,14,17,20,23-octone (PubChem CID 157278961) has the molecular formula C31H36N6O12 and a molecular weight of 684.66 g/mol. Its IUPAC name is 3-[[4-[[5-(2-methylcyclopropyl)pyrazol-1-yl]methyl]phenyl]methyl]-1,7,13,19-tetraoxa-4,10,16,22-tetrazacyclotetracosane-2,5,8,11,14,17,20,23-octone.
| Compound Name | 3-[[4-[[5-(2-methylcyclopropyl)pyrazol-1-yl]methyl]phenyl]methyl]-1,7,13,19-tetraoxa-4,10,16,22-tetrazacyclotetracosane-2,5,8,11,14,17,20,23-octone |
|---|---|
| PubChem CID | 157278961 |
| Molecular Formula | C31H36N6O12 |
| Molecular Weight | 684.66 g/mol |
| Exact Mass | 684.24 |
| IUPAC Name | 3-[[4-[[5-(2-methylcyclopropyl)pyrazol-1-yl]methyl]phenyl]methyl]-1,7,13,19-tetraoxa-4,10,16,22-tetrazacyclotetracosane-2,5,8,11,14,17,20,23-octone |
| SMILES | CC1CC1c1ccnn1Cc1ccc(CC2NC(=O)COC(=O)CNC(=O)COC(=O)CNC(=O)COC(=O)CNC(=O)COC2=O)cc1 |
| InChI | InChI=1S/C31H36N6O12/c1-18-8-21(18)23-6-7-35-37(23)13-20-4-2-19(3-5-20)9-22-31(45)49-16-26(40)34-11-29(43)47-14-24(38)32-10-28(42)46-15-25(39)33-12-30(44)48-17-27(41)36-22/h2-7,18,21-22H,8-17H2,1H3,(H,32,38)(H,33,39)(H,34,40)(H,36,41) |
| InChIKey | AZKYRPDAYGTUPI-UHFFFAOYSA-N |
| XLogP | -2.38 |
| TPSA | 239.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.66 |
| LogP ≤ 5 | -2.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|