About CID 157279903
CID 157279903 (PubChem CID 157279903) has the molecular formula C21H22B3F3O7S
and a molecular weight of 507.90 g/mol.
Molecular Properties
| Compound Name | CID 157279903 |
| PubChem CID | 157279903 |
| Molecular Formula | C21H22B3F3O7S |
| Molecular Weight | 507.90 g/mol |
| Exact Mass | 508.13 |
| IUPAC Name | — |
| SMILES | [B]Cc1cc(C[B])c(C[B])c(C(=O)OC2CC3CC2CC3C(=O)OC(CS(=O)(=O)O)C(F)(F)F)c1 |
| InChI | InChI=1S/C21H22B3F3O7S/c22-6-10-1-13(7-23)16(8-24)15(2-10)20(29)33-17-5-11-3-12(17)4-14(11)19(28)34-18(21(25,26)27)9-35(30,31)32/h1-2,11-12,14,17-18H,3-9H2,(H,30,31,32) |
| InChIKey | PWUDQRIJGJXNKB-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 507.90 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze CID 157279903 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 157279903?
The IUPAC name of CID 157279903 (CID 157279903) is not available.
What is the SMILES notation for CID 157279903?
The canonical SMILES for CID 157279903 is [B]Cc1cc(C[B])c(C[B])c(C(=O)OC2CC3CC2CC3C(=O)OC(CS(=O)(=O)O)C(F)(F)F)c1.
What is the InChIKey of CID 157279903?
The InChIKey is PWUDQRIJGJXNKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22B3F3O7S/c22-6-10-1-13(7-23)16(8-24)15(2-10)20(29)33-17-5-11-3-12(17)4-14(11)19(28)34-18(21(25,26)27)9-35(30,31)32/h1-2,11-12,14,17-18H,3-9H2,(H,30,31,32).
What are the key properties of CID 157279903?
CID 157279903 has a molecular weight of 507.90 g/mol, XLogP of 1.63, 9 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 157279903 is sourced from PubChem (CID 157279903), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).