C12H23F3OSi — CID 157280353
tert-butyl-dimethyl-[(3R,5S)-3,4,5-trifluorocyclohexyl]oxysilane (PubChem CID 157280353) has the molecular formula C12H23F3OSi and a molecular weight of 268.39 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(3R,5S)-3,4,5-trifluorocyclohexyl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[(3R,5S)-3,4,5-trifluorocyclohexyl]oxysilane |
|---|---|
| PubChem CID | 157280353 |
| Molecular Formula | C12H23F3OSi |
| Molecular Weight | 268.39 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | tert-butyl-dimethyl-[(3R,5S)-3,4,5-trifluorocyclohexyl]oxysilane |
| SMILES | CC(C)(C)[Si](C)(C)OC1C[C@@H](F)C(F)[C@@H](F)C1 |
| InChI | InChI=1S/C12H23F3OSi/c1-12(2,3)17(4,5)16-8-6-9(13)11(15)10(14)7-8/h8-11H,6-7H2,1-5H3/t8?,9-,10+,11? |
| InChIKey | AZPAKHVSTVTHCV-GGWWSXTCSA-N |
| XLogP | 4.18 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.39 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|