C31H33FN4O5S — CID 157280700
6-[3-fluoro-5-(2-methylpropoxy)phenyl]-N-[(6-methyl-2-pyridinyl)sulfonyl]-2-(4-pyridin-4-ylbutoxy)pyridine-3-carboxamide (PubChem CID 157280700) has the molecular formula C31H33FN4O5S and a molecular weight of 592.69 g/mol. Its IUPAC name is 6-[3-fluoro-5-(2-methylpropoxy)phenyl]-N-[(6-methyl-2-pyridinyl)sulfonyl]-2-(4-pyridin-4-ylbutoxy)pyridine-3-carboxamide.
| Compound Name | 6-[3-fluoro-5-(2-methylpropoxy)phenyl]-N-[(6-methyl-2-pyridinyl)sulfonyl]-2-(4-pyridin-4-ylbutoxy)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 157280700 |
| Molecular Formula | C31H33FN4O5S |
| Molecular Weight | 592.69 g/mol |
| Exact Mass | 592.22 |
| IUPAC Name | 6-[3-fluoro-5-(2-methylpropoxy)phenyl]-N-[(6-methyl-2-pyridinyl)sulfonyl]-2-(4-pyridin-4-ylbutoxy)pyridine-3-carboxamide |
| SMILES | Cc1cccc(S(=O)(=O)NC(=O)c2ccc(-c3cc(F)cc(OCC(C)C)c3)nc2OCCCCc2ccncc2)n1 |
| InChI | InChI=1S/C31H33FN4O5S/c1-21(2)20-41-26-18-24(17-25(32)19-26)28-11-10-27(30(37)36-42(38,39)29-9-6-7-22(3)34-29)31(35-28)40-16-5-4-8-23-12-14-33-15-13-23/h6-7,9-15,17-19,21H,4-5,8,16,20H2,1-3H3,(H,36,37) |
| InChIKey | MFIRBMIMSSOSJD-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 120.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.69 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|