C27H50O6 — CID 157282176
(6S,8R)-10-[(4S)-2,2-dimethyl-1,3-dioxan-4-yl]-8-ethyl-6,10-dimethyl-7-(oxan-2-yloxy)undecane-2,9-dione;methane (PubChem CID 157282176) has the molecular formula C27H50O6 and a molecular weight of 470.69 g/mol. Its IUPAC name is (6S,8R)-10-[(4S)-2,2-dimethyl-1,3-dioxan-4-yl]-8-ethyl-6,10-dimethyl-7-(oxan-2-yloxy)undecane-2,9-dione;methane.
| Compound Name | (6S,8R)-10-[(4S)-2,2-dimethyl-1,3-dioxan-4-yl]-8-ethyl-6,10-dimethyl-7-(oxan-2-yloxy)undecane-2,9-dione;methane |
|---|---|
| PubChem CID | 157282176 |
| Molecular Formula | C27H50O6 |
| Molecular Weight | 470.69 g/mol |
| Exact Mass | 470.36 |
| IUPAC Name | (6S,8R)-10-[(4S)-2,2-dimethyl-1,3-dioxan-4-yl]-8-ethyl-6,10-dimethyl-7-(oxan-2-yloxy)undecane-2,9-dione;methane |
| SMILES | C.CC[C@@H](C(=O)C(C)(C)[C@@H]1CCOC(C)(C)O1)C(OC1CCCCO1)[C@@H](C)CCCC(C)=O |
| InChI | InChI=1S/C26H46O6.CH4/c1-8-20(24(28)25(4,5)21-15-17-30-26(6,7)32-21)23(18(2)12-11-13-19(3)27)31-22-14-9-10-16-29-22;/h18,20-23H,8-17H2,1-7H3;1H4/t18-,20+,21-,22?,23?;/m0./s1 |
| InChIKey | AZUGWBFLSOISQT-SRMSJZFPSA-N |
| XLogP | 6.09 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.69 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |