C30H43BrF6N2O2Sn — CID 157282229
5-bromo-2-(trifluoromethyl)pyridine;tributyl(1-ethoxyethenyl)stannane;1-[6-(trifluoromethyl)-3-pyridinyl]ethanone (PubChem CID 157282229) has the molecular formula C30H43BrF6N2O2Sn and a molecular weight of 776.29 g/mol. Its IUPAC name is 5-bromo-2-(trifluoromethyl)pyridine;tributyl(1-ethoxyethenyl)stannane;1-[6-(trifluoromethyl)-3-pyridinyl]ethanone.
| Compound Name | 5-bromo-2-(trifluoromethyl)pyridine;tributyl(1-ethoxyethenyl)stannane;1-[6-(trifluoromethyl)-3-pyridinyl]ethanone |
|---|---|
| PubChem CID | 157282229 |
| Molecular Formula | C30H43BrF6N2O2Sn |
| Molecular Weight | 776.29 g/mol |
| Exact Mass | 776.14 |
| IUPAC Name | 5-bromo-2-(trifluoromethyl)pyridine;tributyl(1-ethoxyethenyl)stannane;1-[6-(trifluoromethyl)-3-pyridinyl]ethanone |
| SMILES | C=C(OCC)[Sn](CCCC)(CCCC)CCCC.CC(=O)c1ccc(C(F)(F)F)nc1.FC(F)(F)c1ccc(Br)cn1 |
| InChI | InChI=1S/C8H6F3NO.C6H3BrF3N.C4H7O.3C4H9.Sn/c1-5(13)6-2-3-7(12-4-6)8(9,10)11;7-4-1-2-5(11-3-4)6(8,9)10;1-3-5-4-2;3*1-3-4-2;/h2-4H,1H3;1-3H;1,4H2,2H3;3*1,3-4H2,2H3; |
| InChIKey | AZULLWPNAUYICR-UHFFFAOYSA-N |
| XLogP | 11.09 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 776.29 |
| LogP ≤ 5 | 11.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|