C10H20N2O5 — CID 157283638
(3R,4S)-4-aminooxolan-3-ol;N-[(3S,4R)-4-hydroxyoxolan-3-yl]acetamide (PubChem CID 157283638) has the molecular formula C10H20N2O5 and a molecular weight of 248.28 g/mol. Its IUPAC name is (3R,4S)-4-aminooxolan-3-ol;N-[(3S,4R)-4-hydroxyoxolan-3-yl]acetamide.
| Compound Name | (3R,4S)-4-aminooxolan-3-ol;N-[(3S,4R)-4-hydroxyoxolan-3-yl]acetamide |
|---|---|
| PubChem CID | 157283638 |
| Molecular Formula | C10H20N2O5 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | (3R,4S)-4-aminooxolan-3-ol;N-[(3S,4R)-4-hydroxyoxolan-3-yl]acetamide |
| SMILES | CC(=O)N[C@H]1COC[C@@H]1O.N[C@H]1COC[C@@H]1O |
| InChI | InChI=1S/C6H11NO3.C4H9NO2/c1-4(8)7-5-2-10-3-6(5)9;5-3-1-7-2-4(3)6/h5-6,9H,2-3H2,1H3,(H,7,8);3-4,6H,1-2,5H2/t5-,6-;3-,4-/m00/s1 |
| InChIKey | AZYTYOXORNUVGC-YFZLMZGGSA-N |
| XLogP | -2.41 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | -2.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |