About 2-(chloromethyl)oxirane;4-methoxyphenol;2-[(4-methoxyphenoxy)methyl]oxirane
2-(chloromethyl)oxirane;4-methoxyphenol;2-[(4-methoxyphenoxy)methyl]oxirane (PubChem CID 157284008) has the molecular formula C20H25ClO6
and a molecular weight of 396.87 g/mol. Its IUPAC name is 2-(chloromethyl)oxirane;4-methoxyphenol;2-[(4-methoxyphenoxy)methyl]oxirane.
Molecular Properties
| Compound Name | 2-(chloromethyl)oxirane;4-methoxyphenol;2-[(4-methoxyphenoxy)methyl]oxirane |
| PubChem CID | 157284008 |
| Molecular Formula | C20H25ClO6 |
| Molecular Weight | 396.87 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | 2-(chloromethyl)oxirane;4-methoxyphenol;2-[(4-methoxyphenoxy)methyl]oxirane |
| SMILES | COc1ccc(O)cc1.COc1ccc(OCC2CO2)cc1.ClCC1CO1 |
| InChI | InChI=1S/C10H12O3.C7H8O2.C3H5ClO/c1-11-8-2-4-9(5-3-8)12-6-10-7-13-10;1-9-7-4-2-6(8)3-5-7;4-1-3-2-5-3/h2-5,10H,6-7H2,1H3;2-5,8H,1H3;3H,1-2H2 |
| InChIKey | AZZYEOWSWYLBRT-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 72.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.87 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-(chloromethyl)oxirane;4-methoxyphenol;2-[(4-methoxyphenoxy)methyl]oxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(chloromethyl)oxirane;4-methoxyphenol;2-[(4-methoxyphenoxy)methyl]oxirane?
The IUPAC name of 2-(chloromethyl)oxirane;4-methoxyphenol;2-[(4-methoxyphenoxy)methyl]oxirane (CID 157284008) is 2-(chloromethyl)oxirane;4-methoxyphenol;2-[(4-methoxyphenoxy)methyl]oxirane.
What is the SMILES notation for 2-(chloromethyl)oxirane;4-methoxyphenol;2-[(4-methoxyphenoxy)methyl]oxirane?
The canonical SMILES for 2-(chloromethyl)oxirane;4-methoxyphenol;2-[(4-methoxyphenoxy)methyl]oxirane is COc1ccc(O)cc1.COc1ccc(OCC2CO2)cc1.ClCC1CO1.
What is the InChIKey of 2-(chloromethyl)oxirane;4-methoxyphenol;2-[(4-methoxyphenoxy)methyl]oxirane?
The InChIKey is AZZYEOWSWYLBRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O3.C7H8O2.C3H5ClO/c1-11-8-2-4-9(5-3-8)12-6-10-7-13-10;1-9-7-4-2-6(8)3-5-7;4-1-3-2-5-3/h2-5,10H,6-7H2,1H3;2-5,8H,1H3;3H,1-2H2.
What are the key properties of 2-(chloromethyl)oxirane;4-methoxyphenol;2-[(4-methoxyphenoxy)methyl]oxirane?
2-(chloromethyl)oxirane;4-methoxyphenol;2-[(4-methoxyphenoxy)methyl]oxirane has a molecular weight of 396.87 g/mol, XLogP of 3.50, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(chloromethyl)oxirane;4-methoxyphenol;2-[(4-methoxyphenoxy)methyl]oxirane is sourced from PubChem (CID 157284008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).