C20H36OS2 — CID 157284040
sulfane;(4R,10S)-5,5,9-trimethyl-14-methylidenetetracyclo[11.2.1.01,10.04,9]hexadecan-15-ol (PubChem CID 157284040) has the molecular formula C20H36OS2 and a molecular weight of 356.64 g/mol. Its IUPAC name is sulfane;(4R,10S)-5,5,9-trimethyl-14-methylidenetetracyclo[11.2.1.01,10.04,9]hexadecan-15-ol.
| Compound Name | sulfane;(4R,10S)-5,5,9-trimethyl-14-methylidenetetracyclo[11.2.1.01,10.04,9]hexadecan-15-ol |
|---|---|
| PubChem CID | 157284040 |
| Molecular Formula | C20H36OS2 |
| Molecular Weight | 356.64 g/mol |
| Exact Mass | 356.22 |
| IUPAC Name | sulfane;(4R,10S)-5,5,9-trimethyl-14-methylidenetetracyclo[11.2.1.01,10.04,9]hexadecan-15-ol |
| SMILES | C=C1C2CC[C@@H]3C(CC[C@@H]4C(C)(C)CCCC43C)(C2)C1O.S.S |
| InChI | InChI=1S/C20H32O.2H2S/c1-13-14-6-7-16-19(4)10-5-9-18(2,3)15(19)8-11-20(16,12-14)17(13)21;;/h14-17,21H,1,5-12H2,2-4H3;2*1H2/t14?,15-,16+,17?,19?,20?;;/m1../s1 |
| InChIKey | BAAATYAJXBNFGP-DSVNBDCUSA-N |
| XLogP | 5.17 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.64 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|