About 4-propan-2-yl-3,6-dihydro-2H-pyran;4-propan-2-ylmorpholine;4-propan-2-yloxane
4-propan-2-yl-3,6-dihydro-2H-pyran;4-propan-2-ylmorpholine;4-propan-2-yloxane (PubChem CID 157285576) has the molecular formula C23H45NO3
and a molecular weight of 383.62 g/mol. Its IUPAC name is 4-propan-2-yl-3,6-dihydro-2H-pyran;4-propan-2-ylmorpholine;4-propan-2-yloxane.
Molecular Properties
| Compound Name | 4-propan-2-yl-3,6-dihydro-2H-pyran;4-propan-2-ylmorpholine;4-propan-2-yloxane |
| PubChem CID | 157285576 |
| Molecular Formula | C23H45NO3 |
| Molecular Weight | 383.62 g/mol |
| Exact Mass | 383.34 |
| IUPAC Name | 4-propan-2-yl-3,6-dihydro-2H-pyran;4-propan-2-ylmorpholine;4-propan-2-yloxane |
| SMILES | CC(C)C1=CCOCC1.CC(C)C1CCOCC1.CC(C)N1CCOCC1 |
| InChI | InChI=1S/C8H16O.C8H14O.C7H15NO/c3*1-7(2)8-3-5-9-6-4-8/h7-8H,3-6H2,1-2H3;3,7H,4-6H2,1-2H3;7H,3-6H2,1-2H3 |
| InChIKey | BAEPYWYTCNFWKE-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.62 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-propan-2-yl-3,6-dihydro-2H-pyran;4-propan-2-ylmorpholine;4-propan-2-yloxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-propan-2-yl-3,6-dihydro-2H-pyran;4-propan-2-ylmorpholine;4-propan-2-yloxane?
The IUPAC name of 4-propan-2-yl-3,6-dihydro-2H-pyran;4-propan-2-ylmorpholine;4-propan-2-yloxane (CID 157285576) is 4-propan-2-yl-3,6-dihydro-2H-pyran;4-propan-2-ylmorpholine;4-propan-2-yloxane.
What is the SMILES notation for 4-propan-2-yl-3,6-dihydro-2H-pyran;4-propan-2-ylmorpholine;4-propan-2-yloxane?
The canonical SMILES for 4-propan-2-yl-3,6-dihydro-2H-pyran;4-propan-2-ylmorpholine;4-propan-2-yloxane is CC(C)C1=CCOCC1.CC(C)C1CCOCC1.CC(C)N1CCOCC1.
What is the InChIKey of 4-propan-2-yl-3,6-dihydro-2H-pyran;4-propan-2-ylmorpholine;4-propan-2-yloxane?
The InChIKey is BAEPYWYTCNFWKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O.C8H14O.C7H15NO/c3*1-7(2)8-3-5-9-6-4-8/h7-8H,3-6H2,1-2H3;3,7H,4-6H2,1-2H3;7H,3-6H2,1-2H3.
What are the key properties of 4-propan-2-yl-3,6-dihydro-2H-pyran;4-propan-2-ylmorpholine;4-propan-2-yloxane?
4-propan-2-yl-3,6-dihydro-2H-pyran;4-propan-2-ylmorpholine;4-propan-2-yloxane has a molecular weight of 383.62 g/mol, XLogP of 4.79, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-propan-2-yl-3,6-dihydro-2H-pyran;4-propan-2-ylmorpholine;4-propan-2-yloxane is sourced from PubChem (CID 157285576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).