C27H16F6N4O6 — CID 157286005
1-(1-benzyl-6-nitroindol-3-yl)-2,2,2-trifluoroethanone;2,2,2-trifluoro-1-(6-nitro-1H-indol-3-yl)ethanone (PubChem CID 157286005) has the molecular formula C27H16F6N4O6 and a molecular weight of 606.44 g/mol. Its IUPAC name is 1-(1-benzyl-6-nitroindol-3-yl)-2,2,2-trifluoroethanone;2,2,2-trifluoro-1-(6-nitro-1H-indol-3-yl)ethanone.
| Compound Name | 1-(1-benzyl-6-nitroindol-3-yl)-2,2,2-trifluoroethanone;2,2,2-trifluoro-1-(6-nitro-1H-indol-3-yl)ethanone |
|---|---|
| PubChem CID | 157286005 |
| Molecular Formula | C27H16F6N4O6 |
| Molecular Weight | 606.44 g/mol |
| Exact Mass | 606.10 |
| IUPAC Name | 1-(1-benzyl-6-nitroindol-3-yl)-2,2,2-trifluoroethanone;2,2,2-trifluoro-1-(6-nitro-1H-indol-3-yl)ethanone |
| SMILES | O=C(c1c[nH]c2cc([N+](=O)[O-])ccc12)C(F)(F)F.O=C(c1cn(Cc2ccccc2)c2cc([N+](=O)[O-])ccc12)C(F)(F)F |
| InChI | InChI=1S/C17H11F3N2O3.C10H5F3N2O3/c18-17(19,20)16(23)14-10-21(9-11-4-2-1-3-5-11)15-8-12(22(24)25)6-7-13(14)15;11-10(12,13)9(16)7-4-14-8-3-5(15(17)18)1-2-6(7)8/h1-8,10H,9H2;1-4,14H |
| InChIKey | BAFXRZSNBIPTIA-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 141.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.44 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|