About N-ethylmethanimine;1-methyl-3-propoxybenzene
N-ethylmethanimine;1-methyl-3-propoxybenzene (PubChem CID 157286038) has the molecular formula C13H21NO
and a molecular weight of 207.32 g/mol. Its IUPAC name is N-ethylmethanimine;1-methyl-3-propoxybenzene.
Molecular Properties
| Compound Name | N-ethylmethanimine;1-methyl-3-propoxybenzene |
| PubChem CID | 157286038 |
| Molecular Formula | C13H21NO |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.16 |
| IUPAC Name | N-ethylmethanimine;1-methyl-3-propoxybenzene |
| SMILES | C=NCC.CCCOc1cccc(C)c1 |
| InChI | InChI=1S/C10H14O.C3H7N/c1-3-7-11-10-6-4-5-9(2)8-10;1-3-4-2/h4-6,8H,3,7H2,1-2H3;2-3H2,1H3 |
| InChIKey | BAFZVSGBHZAEIK-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-ethylmethanimine;1-methyl-3-propoxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethylmethanimine;1-methyl-3-propoxybenzene?
The IUPAC name of N-ethylmethanimine;1-methyl-3-propoxybenzene (CID 157286038) is N-ethylmethanimine;1-methyl-3-propoxybenzene.
What is the SMILES notation for N-ethylmethanimine;1-methyl-3-propoxybenzene?
The canonical SMILES for N-ethylmethanimine;1-methyl-3-propoxybenzene is C=NCC.CCCOc1cccc(C)c1.
What is the InChIKey of N-ethylmethanimine;1-methyl-3-propoxybenzene?
The InChIKey is BAFZVSGBHZAEIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O.C3H7N/c1-3-7-11-10-6-4-5-9(2)8-10;1-3-4-2/h4-6,8H,3,7H2,1-2H3;2-3H2,1H3.
What are the key properties of N-ethylmethanimine;1-methyl-3-propoxybenzene?
N-ethylmethanimine;1-methyl-3-propoxybenzene has a molecular weight of 207.32 g/mol, XLogP of 3.49, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethylmethanimine;1-methyl-3-propoxybenzene is sourced from PubChem (CID 157286038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).