About 1,1'-biphenyl;9H-fluorene;hydrazine
1,1'-biphenyl;9H-fluorene;hydrazine (PubChem CID 157286275) has the molecular formula C25H24N2
and a molecular weight of 352.48 g/mol. Its IUPAC name is 1,1'-biphenyl;9H-fluorene;hydrazine.
Molecular Properties
| Compound Name | 1,1'-biphenyl;9H-fluorene;hydrazine |
| PubChem CID | 157286275 |
| Molecular Formula | C25H24N2 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | 1,1'-biphenyl;9H-fluorene;hydrazine |
| SMILES | NN.c1ccc(-c2ccccc2)cc1.c1ccc2c(c1)Cc1ccccc1-2 |
| InChI | InChI=1S/C13H10.C12H10.H4N2/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12;1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-2/h1-8H,9H2;1-10H;1-2H2 |
| InChIKey | BAGQZZHDLQBDLH-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1,1'-biphenyl;9H-fluorene;hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1'-biphenyl;9H-fluorene;hydrazine?
The IUPAC name of 1,1'-biphenyl;9H-fluorene;hydrazine (CID 157286275) is 1,1'-biphenyl;9H-fluorene;hydrazine.
What is the SMILES notation for 1,1'-biphenyl;9H-fluorene;hydrazine?
The canonical SMILES for 1,1'-biphenyl;9H-fluorene;hydrazine is NN.c1ccc(-c2ccccc2)cc1.c1ccc2c(c1)Cc1ccccc1-2.
What is the InChIKey of 1,1'-biphenyl;9H-fluorene;hydrazine?
The InChIKey is BAGQZZHDLQBDLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10.C12H10.H4N2/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12;1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-2/h1-8H,9H2;1-10H;1-2H2.
What are the key properties of 1,1'-biphenyl;9H-fluorene;hydrazine?
1,1'-biphenyl;9H-fluorene;hydrazine has a molecular weight of 352.48 g/mol, XLogP of 5.43, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1'-biphenyl;9H-fluorene;hydrazine is sourced from PubChem (CID 157286275), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).