About 3-amino-2-benzylphenol
3-amino-2-benzylphenol (PubChem CID 15728681) has the molecular formula C13H13NO
and a molecular weight of 199.25 g/mol. Its IUPAC name is 3-amino-2-benzylphenol.
Molecular Properties
| Compound Name | 3-amino-2-benzylphenol |
| PubChem CID | 15728681 |
| Molecular Formula | C13H13NO |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.10 |
| IUPAC Name | 3-amino-2-benzylphenol |
| SMILES | Nc1cccc(O)c1Cc1ccccc1 |
| InChI | InChI=1S/C13H13NO/c14-12-7-4-8-13(15)11(12)9-10-5-2-1-3-6-10/h1-8,15H,9,14H2 |
| InChIKey | GIMGBSVLYMNIMB-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-2-benzylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-2-benzylphenol?
The IUPAC name of 3-amino-2-benzylphenol (CID 15728681) is 3-amino-2-benzylphenol.
What is the SMILES notation for 3-amino-2-benzylphenol?
The canonical SMILES for 3-amino-2-benzylphenol is Nc1cccc(O)c1Cc1ccccc1.
What is the InChIKey of 3-amino-2-benzylphenol?
The InChIKey is GIMGBSVLYMNIMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13NO/c14-12-7-4-8-13(15)11(12)9-10-5-2-1-3-6-10/h1-8,15H,9,14H2.
What are the key properties of 3-amino-2-benzylphenol?
3-amino-2-benzylphenol has a molecular weight of 199.25 g/mol, XLogP of 2.57, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-2-benzylphenol is sourced from PubChem (CID 15728681), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).