About cis-(1R,2S)-2-methoxycyclohexan-1-ol;6-methoxy-2-methylcyclohex-2-en-1-ol
cis-(1R,2S)-2-methoxycyclohexan-1-ol;6-methoxy-2-methylcyclohex-2-en-1-ol (PubChem CID 157288640) has the molecular formula C15H28O4
and a molecular weight of 272.38 g/mol. Its IUPAC name is cis-(1R,2S)-2-methoxycyclohexan-1-ol;6-methoxy-2-methylcyclohex-2-en-1-ol.
Molecular Properties
| Compound Name | cis-(1R,2S)-2-methoxycyclohexan-1-ol;6-methoxy-2-methylcyclohex-2-en-1-ol |
| PubChem CID | 157288640 |
| Molecular Formula | C15H28O4 |
| Molecular Weight | 272.38 g/mol |
| Exact Mass | 272.20 |
| IUPAC Name | cis-(1R,2S)-2-methoxycyclohexan-1-ol;6-methoxy-2-methylcyclohex-2-en-1-ol |
| SMILES | COC1CCC=C(C)C1O.CO[C@H]1CCCC[C@H]1O |
| InChI | InChI=1S/C8H14O2.C7H14O2/c1-6-4-3-5-7(10-2)8(6)9;1-9-7-5-3-2-4-6(7)8/h4,7-9H,3,5H2,1-2H3;6-8H,2-5H2,1H3/t;6-,7+/m.1/s1 |
| InChIKey | BANLXBKOOILCBT-LYZYBISQSA-N |
| XLogP | 2.04 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.38 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze cis-(1R,2S)-2-methoxycyclohexan-1-ol;6-methoxy-2-methylcyclohex-2-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(1R,2S)-2-methoxycyclohexan-1-ol;6-methoxy-2-methylcyclohex-2-en-1-ol?
The IUPAC name of cis-(1R,2S)-2-methoxycyclohexan-1-ol;6-methoxy-2-methylcyclohex-2-en-1-ol (CID 157288640) is cis-(1R,2S)-2-methoxycyclohexan-1-ol;6-methoxy-2-methylcyclohex-2-en-1-ol.
What is the SMILES notation for cis-(1R,2S)-2-methoxycyclohexan-1-ol;6-methoxy-2-methylcyclohex-2-en-1-ol?
The canonical SMILES for cis-(1R,2S)-2-methoxycyclohexan-1-ol;6-methoxy-2-methylcyclohex-2-en-1-ol is COC1CCC=C(C)C1O.CO[C@H]1CCCC[C@H]1O.
What is the InChIKey of cis-(1R,2S)-2-methoxycyclohexan-1-ol;6-methoxy-2-methylcyclohex-2-en-1-ol?
The InChIKey is BANLXBKOOILCBT-LYZYBISQSA-N. The full InChI is InChI=1S/C8H14O2.C7H14O2/c1-6-4-3-5-7(10-2)8(6)9;1-9-7-5-3-2-4-6(7)8/h4,7-9H,3,5H2,1-2H3;6-8H,2-5H2,1H3/t;6-,7+/m.1/s1.
What are the key properties of cis-(1R,2S)-2-methoxycyclohexan-1-ol;6-methoxy-2-methylcyclohex-2-en-1-ol?
cis-(1R,2S)-2-methoxycyclohexan-1-ol;6-methoxy-2-methylcyclohex-2-en-1-ol has a molecular weight of 272.38 g/mol, XLogP of 2.04, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(1R,2S)-2-methoxycyclohexan-1-ol;6-methoxy-2-methylcyclohex-2-en-1-ol is sourced from PubChem (CID 157288640), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).