C22H27ClF3N3O — CID 157288850
N-chloro-1-phenylmethanamine;2-[4-(trifluoromethoxy)phenyl]-2,8-diazaspiro[4.5]decane (PubChem CID 157288850) has the molecular formula C22H27ClF3N3O and a molecular weight of 441.93 g/mol. Its IUPAC name is N-chloro-1-phenylmethanamine;2-[4-(trifluoromethoxy)phenyl]-2,8-diazaspiro[4.5]decane.
| Compound Name | N-chloro-1-phenylmethanamine;2-[4-(trifluoromethoxy)phenyl]-2,8-diazaspiro[4.5]decane |
|---|---|
| PubChem CID | 157288850 |
| Molecular Formula | C22H27ClF3N3O |
| Molecular Weight | 441.93 g/mol |
| Exact Mass | 441.18 |
| IUPAC Name | N-chloro-1-phenylmethanamine;2-[4-(trifluoromethoxy)phenyl]-2,8-diazaspiro[4.5]decane |
| SMILES | ClNCc1ccccc1.FC(F)(F)Oc1ccc(N2CCC3(CCNCC3)C2)cc1 |
| InChI | InChI=1S/C15H19F3N2O.C7H8ClN/c16-15(17,18)21-13-3-1-12(2-4-13)20-10-7-14(11-20)5-8-19-9-6-14;8-9-6-7-4-2-1-3-5-7/h1-4,19H,5-11H2;1-5,9H,6H2 |
| InChIKey | BAODHBDNNMUGHC-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 36.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.93 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|