About 1-methyl-3-methylidenecyclohexane;2-methyloxane
1-methyl-3-methylidenecyclohexane;2-methyloxane (PubChem CID 157289946) has the molecular formula C14H26O
and a molecular weight of 210.36 g/mol. Its IUPAC name is 1-methyl-3-methylidenecyclohexane;2-methyloxane.
Molecular Properties
| Compound Name | 1-methyl-3-methylidenecyclohexane;2-methyloxane |
| PubChem CID | 157289946 |
| Molecular Formula | C14H26O |
| Molecular Weight | 210.36 g/mol |
| Exact Mass | 210.20 |
| IUPAC Name | 1-methyl-3-methylidenecyclohexane;2-methyloxane |
| SMILES | C=C1CCCC(C)C1.CC1CCCCO1 |
| InChI | InChI=1S/C8H14.C6H12O/c1-7-4-3-5-8(2)6-7;1-6-4-2-3-5-7-6/h8H,1,3-6H2,2H3;6H,2-5H2,1H3 |
| InChIKey | BARKOUCNKNUMFO-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.36 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-3-methylidenecyclohexane;2-methyloxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-3-methylidenecyclohexane;2-methyloxane?
The IUPAC name of 1-methyl-3-methylidenecyclohexane;2-methyloxane (CID 157289946) is 1-methyl-3-methylidenecyclohexane;2-methyloxane.
What is the SMILES notation for 1-methyl-3-methylidenecyclohexane;2-methyloxane?
The canonical SMILES for 1-methyl-3-methylidenecyclohexane;2-methyloxane is C=C1CCCC(C)C1.CC1CCCCO1.
What is the InChIKey of 1-methyl-3-methylidenecyclohexane;2-methyloxane?
The InChIKey is BARKOUCNKNUMFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14.C6H12O/c1-7-4-3-5-8(2)6-7;1-6-4-2-3-5-7-6/h8H,1,3-6H2,2H3;6H,2-5H2,1H3.
What are the key properties of 1-methyl-3-methylidenecyclohexane;2-methyloxane?
1-methyl-3-methylidenecyclohexane;2-methyloxane has a molecular weight of 210.36 g/mol, XLogP of 4.33, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-3-methylidenecyclohexane;2-methyloxane is sourced from PubChem (CID 157289946), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).