C10H14ClN5 — CID 15729053
6-chloro-2-N-(2-methylprop-2-enyl)-4-N-prop-2-enyl-1,3,5-triazine-2,4-diamine (PubChem CID 15729053) has the molecular formula C10H14ClN5 and a molecular weight of 239.71 g/mol. Its IUPAC name is 6-chloro-2-N-(2-methylprop-2-enyl)-4-N-prop-2-enyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-chloro-2-N-(2-methylprop-2-enyl)-4-N-prop-2-enyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 15729053 |
| Molecular Formula | C10H14ClN5 |
| Molecular Weight | 239.71 g/mol |
| Exact Mass | 239.09 |
| IUPAC Name | 6-chloro-2-N-(2-methylprop-2-enyl)-4-N-prop-2-enyl-1,3,5-triazine-2,4-diamine |
| SMILES | C=CCNc1nc(Cl)nc(NCC(=C)C)n1 |
| InChI | InChI=1S/C10H14ClN5/c1-4-5-12-9-14-8(11)15-10(16-9)13-6-7(2)3/h4H,1-2,5-6H2,3H3,(H2,12,13,14,15,16) |
| InChIKey | RKLHLRHKASAWRJ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.71 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|