About 5-chloro-2-(2-ethoxyethylamino)pyridine-3-carboxylic acid;2-ethoxyethanol
5-chloro-2-(2-ethoxyethylamino)pyridine-3-carboxylic acid;2-ethoxyethanol (PubChem CID 157290725) has the molecular formula C14H23ClN2O5
and a molecular weight of 334.80 g/mol. Its IUPAC name is 5-chloro-2-(2-ethoxyethylamino)pyridine-3-carboxylic acid;2-ethoxyethanol.
Molecular Properties
| Compound Name | 5-chloro-2-(2-ethoxyethylamino)pyridine-3-carboxylic acid;2-ethoxyethanol |
| PubChem CID | 157290725 |
| Molecular Formula | C14H23ClN2O5 |
| Molecular Weight | 334.80 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | 5-chloro-2-(2-ethoxyethylamino)pyridine-3-carboxylic acid;2-ethoxyethanol |
| SMILES | CCOCCNc1ncc(Cl)cc1C(=O)O.CCOCCO |
| InChI | InChI=1S/C10H13ClN2O3.C4H10O2/c1-2-16-4-3-12-9-8(10(14)15)5-7(11)6-13-9;1-2-6-4-3-5/h5-6H,2-4H2,1H3,(H,12,13)(H,14,15);5H,2-4H2,1H3 |
| InChIKey | BATQQTUYTRLILY-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 100.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.80 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-chloro-2-(2-ethoxyethylamino)pyridine-3-carboxylic acid;2-ethoxyethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-2-(2-ethoxyethylamino)pyridine-3-carboxylic acid;2-ethoxyethanol?
The IUPAC name of 5-chloro-2-(2-ethoxyethylamino)pyridine-3-carboxylic acid;2-ethoxyethanol (CID 157290725) is 5-chloro-2-(2-ethoxyethylamino)pyridine-3-carboxylic acid;2-ethoxyethanol.
What is the SMILES notation for 5-chloro-2-(2-ethoxyethylamino)pyridine-3-carboxylic acid;2-ethoxyethanol?
The canonical SMILES for 5-chloro-2-(2-ethoxyethylamino)pyridine-3-carboxylic acid;2-ethoxyethanol is CCOCCNc1ncc(Cl)cc1C(=O)O.CCOCCO.
What is the InChIKey of 5-chloro-2-(2-ethoxyethylamino)pyridine-3-carboxylic acid;2-ethoxyethanol?
The InChIKey is BATQQTUYTRLILY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13ClN2O3.C4H10O2/c1-2-16-4-3-12-9-8(10(14)15)5-7(11)6-13-9;1-2-6-4-3-5/h5-6H,2-4H2,1H3,(H,12,13)(H,14,15);5H,2-4H2,1H3.
What are the key properties of 5-chloro-2-(2-ethoxyethylamino)pyridine-3-carboxylic acid;2-ethoxyethanol?
5-chloro-2-(2-ethoxyethylamino)pyridine-3-carboxylic acid;2-ethoxyethanol has a molecular weight of 334.80 g/mol, XLogP of 1.90, 9 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-2-(2-ethoxyethylamino)pyridine-3-carboxylic acid;2-ethoxyethanol is sourced from PubChem (CID 157290725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).