C19H13F3N2O4S — CID 15729115
S-phenyl 5-methyl-4-[[4-(trifluoromethoxy)phenyl]carbamoyl]-1,2-oxazole-3-carbothioate (PubChem CID 15729115) has the molecular formula C19H13F3N2O4S and a molecular weight of 422.38 g/mol. Its IUPAC name is S-phenyl 5-methyl-4-[[4-(trifluoromethoxy)phenyl]carbamoyl]-1,2-oxazole-3-carbothioate.
| Compound Name | S-phenyl 5-methyl-4-[[4-(trifluoromethoxy)phenyl]carbamoyl]-1,2-oxazole-3-carbothioate |
|---|---|
| PubChem CID | 15729115 |
| Molecular Formula | C19H13F3N2O4S |
| Molecular Weight | 422.38 g/mol |
| Exact Mass | 422.05 |
| IUPAC Name | S-phenyl 5-methyl-4-[[4-(trifluoromethoxy)phenyl]carbamoyl]-1,2-oxazole-3-carbothioate |
| SMILES | Cc1onc(C(=O)Sc2ccccc2)c1C(=O)Nc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C19H13F3N2O4S/c1-11-15(16(24-28-11)18(26)29-14-5-3-2-4-6-14)17(25)23-12-7-9-13(10-8-12)27-19(20,21)22/h2-10H,1H3,(H,23,25) |
| InChIKey | UMIIDACXGOBWRP-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.38 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|