About 9H-fluorene;methyl 1H-pyrazole-4-carboxylate
9H-fluorene;methyl 1H-pyrazole-4-carboxylate (PubChem CID 157291728) has the molecular formula C18H16N2O2
and a molecular weight of 292.34 g/mol. Its IUPAC name is 9H-fluorene;methyl 1H-pyrazole-4-carboxylate.
Molecular Properties
| Compound Name | 9H-fluorene;methyl 1H-pyrazole-4-carboxylate |
| PubChem CID | 157291728 |
| Molecular Formula | C18H16N2O2 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | 9H-fluorene;methyl 1H-pyrazole-4-carboxylate |
| SMILES | COC(=O)c1cn[nH]c1.c1ccc2c(c1)Cc1ccccc1-2 |
| InChI | InChI=1S/C13H10.C5H6N2O2/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12;1-9-5(8)4-2-6-7-3-4/h1-8H,9H2;2-3H,1H3,(H,6,7) |
| InChIKey | BAWPPOGGQUZSHY-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 9H-fluorene;methyl 1H-pyrazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9H-fluorene;methyl 1H-pyrazole-4-carboxylate?
The IUPAC name of 9H-fluorene;methyl 1H-pyrazole-4-carboxylate (CID 157291728) is 9H-fluorene;methyl 1H-pyrazole-4-carboxylate.
What is the SMILES notation for 9H-fluorene;methyl 1H-pyrazole-4-carboxylate?
The canonical SMILES for 9H-fluorene;methyl 1H-pyrazole-4-carboxylate is COC(=O)c1cn[nH]c1.c1ccc2c(c1)Cc1ccccc1-2.
What is the InChIKey of 9H-fluorene;methyl 1H-pyrazole-4-carboxylate?
The InChIKey is BAWPPOGGQUZSHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10.C5H6N2O2/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12;1-9-5(8)4-2-6-7-3-4/h1-8H,9H2;2-3H,1H3,(H,6,7).
What are the key properties of 9H-fluorene;methyl 1H-pyrazole-4-carboxylate?
9H-fluorene;methyl 1H-pyrazole-4-carboxylate has a molecular weight of 292.34 g/mol, XLogP of 3.45, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9H-fluorene;methyl 1H-pyrazole-4-carboxylate is sourced from PubChem (CID 157291728), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).