About 5-(1-methyltetrazol-5-yl)sulfanyl-1,3-thiazol-2-amine
5-(1-methyltetrazol-5-yl)sulfanyl-1,3-thiazol-2-amine (PubChem CID 15729186) has the molecular formula C5H6N6S2
and a molecular weight of 214.28 g/mol. Its IUPAC name is 5-(1-methyltetrazol-5-yl)sulfanyl-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | 5-(1-methyltetrazol-5-yl)sulfanyl-1,3-thiazol-2-amine |
| PubChem CID | 15729186 |
| Molecular Formula | C5H6N6S2 |
| Molecular Weight | 214.28 g/mol |
| Exact Mass | 214.01 |
| IUPAC Name | 5-(1-methyltetrazol-5-yl)sulfanyl-1,3-thiazol-2-amine |
| SMILES | Cn1nnnc1Sc1cnc(N)s1 |
| InChI | InChI=1S/C5H6N6S2/c1-11-5(8-9-10-11)13-3-2-7-4(6)12-3/h2H,1H3,(H2,6,7) |
| InChIKey | SSLALRPEICISIZ-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 82.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.28 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 5-(1-methyltetrazol-5-yl)sulfanyl-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1-methyltetrazol-5-yl)sulfanyl-1,3-thiazol-2-amine?
The IUPAC name of 5-(1-methyltetrazol-5-yl)sulfanyl-1,3-thiazol-2-amine (CID 15729186) is 5-(1-methyltetrazol-5-yl)sulfanyl-1,3-thiazol-2-amine.
What is the SMILES notation for 5-(1-methyltetrazol-5-yl)sulfanyl-1,3-thiazol-2-amine?
The canonical SMILES for 5-(1-methyltetrazol-5-yl)sulfanyl-1,3-thiazol-2-amine is Cn1nnnc1Sc1cnc(N)s1.
What is the InChIKey of 5-(1-methyltetrazol-5-yl)sulfanyl-1,3-thiazol-2-amine?
The InChIKey is SSLALRPEICISIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6N6S2/c1-11-5(8-9-10-11)13-3-2-7-4(6)12-3/h2H,1H3,(H2,6,7).
What are the key properties of 5-(1-methyltetrazol-5-yl)sulfanyl-1,3-thiazol-2-amine?
5-(1-methyltetrazol-5-yl)sulfanyl-1,3-thiazol-2-amine has a molecular weight of 214.28 g/mol, XLogP of 0.40, 2 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1-methyltetrazol-5-yl)sulfanyl-1,3-thiazol-2-amine is sourced from PubChem (CID 15729186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).