C8H12F7NO — CID 157292288
4-(2,2,3,3,4,4,4-heptafluorobutoxy)butan-2-amine (PubChem CID 157292288) has the molecular formula C8H12F7NO and a molecular weight of 271.18 g/mol. Its IUPAC name is 4-(2,2,3,3,4,4,4-heptafluorobutoxy)butan-2-amine.
| Compound Name | 4-(2,2,3,3,4,4,4-heptafluorobutoxy)butan-2-amine |
|---|---|
| PubChem CID | 157292288 |
| Molecular Formula | C8H12F7NO |
| Molecular Weight | 271.18 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | 4-(2,2,3,3,4,4,4-heptafluorobutoxy)butan-2-amine |
| SMILES | CC(N)CCOCC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H12F7NO/c1-5(16)2-3-17-4-6(9,10)7(11,12)8(13,14)15/h5H,2-4,16H2,1H3 |
| InChIKey | BAYFLTNZNZHHKE-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.18 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|