C25H30ClI2N3O4 — CID 157292651
1-[4-[2-[4-(3-chloro-2-methylpropoxy)phenyl]propan-2-yl]-2-(123I)iodophenoxy]-3-[4-(hydroxymethyl)-5-iodotriazol-1-yl]propan-2-ol (PubChem CID 157292651) has the molecular formula C25H30ClI2N3O4 and a molecular weight of 721.79 g/mol. Its IUPAC name is 1-[4-[2-[4-(3-chloro-2-methylpropoxy)phenyl]propan-2-yl]-2-(123I)iodophenoxy]-3-[4-(hydroxymethyl)-5-iodotriazol-1-yl]propan-2-ol.
| Compound Name | 1-[4-[2-[4-(3-chloro-2-methylpropoxy)phenyl]propan-2-yl]-2-(123I)iodophenoxy]-3-[4-(hydroxymethyl)-5-iodotriazol-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 157292651 |
| Molecular Formula | C25H30ClI2N3O4 |
| Molecular Weight | 721.79 g/mol |
| Exact Mass | 721.00 |
| IUPAC Name | 1-[4-[2-[4-(3-chloro-2-methylpropoxy)phenyl]propan-2-yl]-2-(123I)iodophenoxy]-3-[4-(hydroxymethyl)-5-iodotriazol-1-yl]propan-2-ol |
| SMILES | CC(CCl)COc1ccc(C(C)(C)c2ccc(OCC(O)Cn3nnc(CO)c3I)c([123I])c2)cc1 |
| InChI | InChI=1S/C25H30ClI2N3O4/c1-16(11-26)14-34-20-7-4-17(5-8-20)25(2,3)18-6-9-23(21(27)10-18)35-15-19(33)12-31-24(28)22(13-32)29-30-31/h4-10,16,19,32-33H,11-15H2,1-3H3/i27-4 |
| InChIKey | JWXHSMRBCWLRQH-AHGYSWSPSA-N |
| XLogP | 5.00 |
| TPSA | 89.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.79 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|