C28H32 — CID 157292740
1,2-dibutylnaphthalene;naphthalene (PubChem CID 157292740) has the molecular formula C28H32 and a molecular weight of 368.56 g/mol. Its IUPAC name is 1,2-dibutylnaphthalene;naphthalene.
| Compound Name | 1,2-dibutylnaphthalene;naphthalene |
|---|---|
| PubChem CID | 157292740 |
| Molecular Formula | C28H32 |
| Molecular Weight | 368.56 g/mol |
| Exact Mass | 368.25 |
| IUPAC Name | 1,2-dibutylnaphthalene;naphthalene |
| SMILES | CCCCc1ccc2ccccc2c1CCCC.c1ccc2ccccc2c1 |
| InChI | InChI=1S/C18H24.C10H8/c1-3-5-9-15-13-14-16-10-7-8-12-18(16)17(15)11-6-4-2;1-2-6-10-8-4-3-7-9(10)5-1/h7-8,10,12-14H,3-6,9,11H2,1-2H3;1-8H |
| InChIKey | BAZKBKNEBYBAML-UHFFFAOYSA-N |
| XLogP | 8.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.56 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |