C47H35N3 — CID 157292922
2,4-diphenyl-6-[4-[4-(7,9,9-trimethylfluoren-2-yl)naphthalen-1-yl]phenyl]-1,3,5-triazine (PubChem CID 157292922) has the molecular formula C47H35N3 and a molecular weight of 641.82 g/mol. Its IUPAC name is 2,4-diphenyl-6-[4-[4-(7,9,9-trimethylfluoren-2-yl)naphthalen-1-yl]phenyl]-1,3,5-triazine.
| Compound Name | 2,4-diphenyl-6-[4-[4-(7,9,9-trimethylfluoren-2-yl)naphthalen-1-yl]phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 157292922 |
| Molecular Formula | C47H35N3 |
| Molecular Weight | 641.82 g/mol |
| Exact Mass | 641.28 |
| IUPAC Name | 2,4-diphenyl-6-[4-[4-(7,9,9-trimethylfluoren-2-yl)naphthalen-1-yl]phenyl]-1,3,5-triazine |
| SMILES | Cc1ccc2c(c1)C(C)(C)c1cc(-c3ccc(-c4ccc(-c5nc(-c6ccccc6)nc(-c6ccccc6)n5)cc4)c4ccccc34)ccc1-2 |
| InChI | InChI=1S/C47H35N3/c1-30-18-24-40-41-25-23-35(29-43(41)47(2,3)42(40)28-30)37-27-26-36(38-16-10-11-17-39(37)38)31-19-21-34(22-20-31)46-49-44(32-12-6-4-7-13-32)48-45(50-46)33-14-8-5-9-15-33/h4-29H,1-3H3 |
| InChIKey | INWUWGCBCFRBAZ-UHFFFAOYSA-N |
| XLogP | 11.97 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.82 |
| LogP ≤ 5 | 11.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |