C20H14F12O4 — CID 15729336
[1,1,1,3,3,3-hexafluoro-2-[4-[1,1,1,3,3,3-hexafluoro-2-(2-methylprop-2-enoyloxy)propan-2-yl]phenyl]propan-2-yl] 2-methylprop-2-enoate (PubChem CID 15729336) has the molecular formula C20H14F12O4 and a molecular weight of 546.30 g/mol. Its IUPAC name is [1,1,1,3,3,3-hexafluoro-2-[4-[1,1,1,3,3,3-hexafluoro-2-(2-methylprop-2-enoyloxy)propan-2-yl]phenyl]propan-2-yl] 2-methylprop-2-enoate.
| Compound Name | [1,1,1,3,3,3-hexafluoro-2-[4-[1,1,1,3,3,3-hexafluoro-2-(2-methylprop-2-enoyloxy)propan-2-yl]phenyl]propan-2-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 15729336 |
| Molecular Formula | C20H14F12O4 |
| Molecular Weight | 546.30 g/mol |
| Exact Mass | 546.07 |
| IUPAC Name | [1,1,1,3,3,3-hexafluoro-2-[4-[1,1,1,3,3,3-hexafluoro-2-(2-methylprop-2-enoyloxy)propan-2-yl]phenyl]propan-2-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(c1ccc(C(OC(=O)C(=C)C)(C(F)(F)F)C(F)(F)F)cc1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C20H14F12O4/c1-9(2)13(33)35-15(17(21,22)23,18(24,25)26)11-5-7-12(8-6-11)16(19(27,28)29,20(30,31)32)36-14(34)10(3)4/h5-8H,1,3H2,2,4H3 |
| InChIKey | QRGMBMWEDOABAD-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.30 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|