C32H31Cl3N4O2 — CID 157294621
13-chloro-4-oxido-2-piperazin-1-yl-4-azoniatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene;2,13-dichloro-4-oxido-4-azoniatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene (PubChem CID 157294621) has the molecular formula C32H31Cl3N4O2 and a molecular weight of 609.99 g/mol. Its IUPAC name is 13-chloro-4-oxido-2-piperazin-1-yl-4-azoniatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene;2,13-dichloro-4-oxido-4-azoniatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene.
| Compound Name | 13-chloro-4-oxido-2-piperazin-1-yl-4-azoniatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene;2,13-dichloro-4-oxido-4-azoniatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene |
|---|---|
| PubChem CID | 157294621 |
| Molecular Formula | C32H31Cl3N4O2 |
| Molecular Weight | 609.99 g/mol |
| Exact Mass | 608.15 |
| IUPAC Name | 13-chloro-4-oxido-2-piperazin-1-yl-4-azoniatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene;2,13-dichloro-4-oxido-4-azoniatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene |
| SMILES | [O-][n+]1cccc2c1C(Cl)c1ccc(Cl)cc1CC2.[O-][n+]1cccc2c1C(N1CCNCC1)c1ccc(Cl)cc1CC2 |
| InChI | InChI=1S/C18H20ClN3O.C14H11Cl2NO/c19-15-5-6-16-14(12-15)4-3-13-2-1-9-22(23)17(13)18(16)21-10-7-20-8-11-21;15-11-5-6-12-10(8-11)4-3-9-2-1-7-17(18)14(9)13(12)16/h1-2,5-6,9,12,18,20H,3-4,7-8,10-11H2;1-2,5-8,13H,3-4H2 |
| InChIKey | BBEYISPNSCRGOL-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.99 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|