About decyl ethyl hydrogen phosphate;3,3-dimethylbut-1-ene
decyl ethyl hydrogen phosphate;3,3-dimethylbut-1-ene (PubChem CID 157296239) has the molecular formula C18H39O4P
and a molecular weight of 350.48 g/mol. Its IUPAC name is decyl ethyl hydrogen phosphate;3,3-dimethylbut-1-ene.
Molecular Properties
| Compound Name | decyl ethyl hydrogen phosphate;3,3-dimethylbut-1-ene |
| PubChem CID | 157296239 |
| Molecular Formula | C18H39O4P |
| Molecular Weight | 350.48 g/mol |
| Exact Mass | 350.26 |
| IUPAC Name | decyl ethyl hydrogen phosphate;3,3-dimethylbut-1-ene |
| SMILES | C=CC(C)(C)C.CCCCCCCCCCOP(=O)(O)OCC |
| InChI | InChI=1S/C12H27O4P.C6H12/c1-3-5-6-7-8-9-10-11-12-16-17(13,14)15-4-2;1-5-6(2,3)4/h3-12H2,1-2H3,(H,13,14);5H,1H2,2-4H3 |
| InChIKey | BBJLZRTUSXPWQA-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 350.48 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze decyl ethyl hydrogen phosphate;3,3-dimethylbut-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of decyl ethyl hydrogen phosphate;3,3-dimethylbut-1-ene?
The IUPAC name of decyl ethyl hydrogen phosphate;3,3-dimethylbut-1-ene (CID 157296239) is decyl ethyl hydrogen phosphate;3,3-dimethylbut-1-ene.
What is the SMILES notation for decyl ethyl hydrogen phosphate;3,3-dimethylbut-1-ene?
The canonical SMILES for decyl ethyl hydrogen phosphate;3,3-dimethylbut-1-ene is C=CC(C)(C)C.CCCCCCCCCCOP(=O)(O)OCC.
What is the InChIKey of decyl ethyl hydrogen phosphate;3,3-dimethylbut-1-ene?
The InChIKey is BBJLZRTUSXPWQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H27O4P.C6H12/c1-3-5-6-7-8-9-10-11-12-16-17(13,14)15-4-2;1-5-6(2,3)4/h3-12H2,1-2H3,(H,13,14);5H,1H2,2-4H3.
What are the key properties of decyl ethyl hydrogen phosphate;3,3-dimethylbut-1-ene?
decyl ethyl hydrogen phosphate;3,3-dimethylbut-1-ene has a molecular weight of 350.48 g/mol, XLogP of 6.50, 12 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for decyl ethyl hydrogen phosphate;3,3-dimethylbut-1-ene is sourced from PubChem (CID 157296239), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).