C33H36OS2 — CID 157296421
2-propan-2-yl-1-benzofuran;2-propan-2-yl-1-benzothiophene;3-propan-2-yl-1-benzothiophene (PubChem CID 157296421) has the molecular formula C33H36OS2 and a molecular weight of 512.78 g/mol. Its IUPAC name is 2-propan-2-yl-1-benzofuran;2-propan-2-yl-1-benzothiophene;3-propan-2-yl-1-benzothiophene.
| Compound Name | 2-propan-2-yl-1-benzofuran;2-propan-2-yl-1-benzothiophene;3-propan-2-yl-1-benzothiophene |
|---|---|
| PubChem CID | 157296421 |
| Molecular Formula | C33H36OS2 |
| Molecular Weight | 512.78 g/mol |
| Exact Mass | 512.22 |
| IUPAC Name | 2-propan-2-yl-1-benzofuran;2-propan-2-yl-1-benzothiophene;3-propan-2-yl-1-benzothiophene |
| SMILES | CC(C)c1cc2ccccc2o1.CC(C)c1cc2ccccc2s1.CC(C)c1csc2ccccc12 |
| InChI | InChI=1S/C11H12O.2C11H12S/c1-8(2)11-7-9-5-3-4-6-10(9)12-11;1-8(2)10-7-12-11-6-4-3-5-9(10)11;1-8(2)11-7-9-5-3-4-6-10(9)12-11/h3*3-8H,1-2H3 |
| InChIKey | BBJZPYOFQFIJKQ-UHFFFAOYSA-N |
| XLogP | 11.61 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.78 |
| LogP ≤ 5 | 11.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |