C6H14O2PTi+ — CID 157296443
2,3-dimethylbutan-2-yloxy(oxo)phosphanium;titanium (PubChem CID 157296443) has the molecular formula C6H14O2PTi+ and a molecular weight of 197.02 g/mol. Its IUPAC name is 2,3-dimethylbutan-2-yloxy(oxo)phosphanium;titanium.
| Compound Name | 2,3-dimethylbutan-2-yloxy(oxo)phosphanium;titanium |
|---|---|
| PubChem CID | 157296443 |
| Molecular Formula | C6H14O2PTi+ |
| Molecular Weight | 197.02 g/mol |
| Exact Mass | 197.02 |
| IUPAC Name | 2,3-dimethylbutan-2-yloxy(oxo)phosphanium;titanium |
| SMILES | CC(C)C(C)(C)O[PH+]=O.[Ti] |
| InChI | InChI=1S/C6H14O2P.Ti/c1-5(2)6(3,4)8-9-7;/h5,9H,1-4H3;/q+1; |
| InChIKey | AEUCWNRDXAOCID-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.02 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|