About chloro-[(3,4-dichlorophenyl)methyl]-tris(3-methylphenyl)-λ5-phosphane
chloro-[(3,4-dichlorophenyl)methyl]-tris(3-methylphenyl)-λ5-phosphane (PubChem CID 15729723) has the molecular formula C28H26Cl3P
and a molecular weight of 499.85 g/mol. Its IUPAC name is chloro-[(3,4-dichlorophenyl)methyl]-tris(3-methylphenyl)-λ5-phosphane.
Molecular Properties
| Compound Name | chloro-[(3,4-dichlorophenyl)methyl]-tris(3-methylphenyl)-λ5-phosphane |
| PubChem CID | 15729723 |
| Molecular Formula | C28H26Cl3P |
| Molecular Weight | 499.85 g/mol |
| Exact Mass | 498.08 |
| IUPAC Name | chloro-[(3,4-dichlorophenyl)methyl]-tris(3-methylphenyl)-λ5-phosphane |
| SMILES | Cc1cccc(P(Cl)(Cc2ccc(Cl)c(Cl)c2)(c2cccc(C)c2)c2cccc(C)c2)c1 |
| InChI | InChI=1S/C28H26Cl3P/c1-20-7-4-10-24(15-20)32(31,25-11-5-8-21(2)16-25,26-12-6-9-22(3)17-26)19-23-13-14-27(29)28(30)18-23/h4-18H,19H2,1-3H3 |
| InChIKey | DKNMFLOXZFTVIR-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 499.85 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze chloro-[(3,4-dichlorophenyl)methyl]-tris(3-methylphenyl)-λ5-phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloro-[(3,4-dichlorophenyl)methyl]-tris(3-methylphenyl)-λ5-phosphane?
The IUPAC name of chloro-[(3,4-dichlorophenyl)methyl]-tris(3-methylphenyl)-λ5-phosphane (CID 15729723) is chloro-[(3,4-dichlorophenyl)methyl]-tris(3-methylphenyl)-λ5-phosphane.
What is the SMILES notation for chloro-[(3,4-dichlorophenyl)methyl]-tris(3-methylphenyl)-λ5-phosphane?
The canonical SMILES for chloro-[(3,4-dichlorophenyl)methyl]-tris(3-methylphenyl)-λ5-phosphane is Cc1cccc(P(Cl)(Cc2ccc(Cl)c(Cl)c2)(c2cccc(C)c2)c2cccc(C)c2)c1.
What is the InChIKey of chloro-[(3,4-dichlorophenyl)methyl]-tris(3-methylphenyl)-λ5-phosphane?
The InChIKey is DKNMFLOXZFTVIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H26Cl3P/c1-20-7-4-10-24(15-20)32(31,25-11-5-8-21(2)16-25,26-12-6-9-22(3)17-26)19-23-13-14-27(29)28(30)18-23/h4-18H,19H2,1-3H3.
What are the key properties of chloro-[(3,4-dichlorophenyl)methyl]-tris(3-methylphenyl)-λ5-phosphane?
chloro-[(3,4-dichlorophenyl)methyl]-tris(3-methylphenyl)-λ5-phosphane has a molecular weight of 499.85 g/mol, XLogP of 8.10, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for chloro-[(3,4-dichlorophenyl)methyl]-tris(3-methylphenyl)-λ5-phosphane is sourced from PubChem (CID 15729723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).