C22H18N2O3 — CID 157297703
(2S)-2-hydroxy-1-[6-[4-(4-isocyanophenoxy)phenyl]-2-pyridinyl]butan-1-one (PubChem CID 157297703) has the molecular formula C22H18N2O3 and a molecular weight of 358.40 g/mol. Its IUPAC name is (2S)-2-hydroxy-1-[6-[4-(4-isocyanophenoxy)phenyl]-2-pyridinyl]butan-1-one.
| Compound Name | (2S)-2-hydroxy-1-[6-[4-(4-isocyanophenoxy)phenyl]-2-pyridinyl]butan-1-one |
|---|---|
| PubChem CID | 157297703 |
| Molecular Formula | C22H18N2O3 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | (2S)-2-hydroxy-1-[6-[4-(4-isocyanophenoxy)phenyl]-2-pyridinyl]butan-1-one |
| SMILES | [C-]#[N+]c1ccc(Oc2ccc(-c3cccc(C(=O)[C@@H](O)CC)n3)cc2)cc1 |
| InChI | InChI=1S/C22H18N2O3/c1-3-21(25)22(26)20-6-4-5-19(24-20)15-7-11-17(12-8-15)27-18-13-9-16(23-2)10-14-18/h4-14,21,25H,3H2,1H3/t21-/m0/s1 |
| InChIKey | QNPKMMRNHRCZOQ-NRFANRHFSA-N |
| XLogP | 5.05 |
| TPSA | 63.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|