About 2-(4-chloro-2-pyridinyl)propan-2-ol;ethyl 4-chloropyridine-2-carboxylate
2-(4-chloro-2-pyridinyl)propan-2-ol;ethyl 4-chloropyridine-2-carboxylate (PubChem CID 157297902) has the molecular formula C16H18Cl2N2O3
and a molecular weight of 357.24 g/mol. Its IUPAC name is 2-(4-chloro-2-pyridinyl)propan-2-ol;ethyl 4-chloropyridine-2-carboxylate.
Molecular Properties
| Compound Name | 2-(4-chloro-2-pyridinyl)propan-2-ol;ethyl 4-chloropyridine-2-carboxylate |
| PubChem CID | 157297902 |
| Molecular Formula | C16H18Cl2N2O3 |
| Molecular Weight | 357.24 g/mol |
| Exact Mass | 356.07 |
| IUPAC Name | 2-(4-chloro-2-pyridinyl)propan-2-ol;ethyl 4-chloropyridine-2-carboxylate |
| SMILES | CC(C)(O)c1cc(Cl)ccn1.CCOC(=O)c1cc(Cl)ccn1 |
| InChI | InChI=1S/C8H8ClNO2.C8H10ClNO/c1-2-12-8(11)7-5-6(9)3-4-10-7;1-8(2,11)7-5-6(9)3-4-10-7/h3-5H,2H2,1H3;3-5,11H,1-2H3 |
| InChIKey | BBOADJTZCZXXGM-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 72.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.24 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(4-chloro-2-pyridinyl)propan-2-ol;ethyl 4-chloropyridine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-chloro-2-pyridinyl)propan-2-ol;ethyl 4-chloropyridine-2-carboxylate?
The IUPAC name of 2-(4-chloro-2-pyridinyl)propan-2-ol;ethyl 4-chloropyridine-2-carboxylate (CID 157297902) is 2-(4-chloro-2-pyridinyl)propan-2-ol;ethyl 4-chloropyridine-2-carboxylate.
What is the SMILES notation for 2-(4-chloro-2-pyridinyl)propan-2-ol;ethyl 4-chloropyridine-2-carboxylate?
The canonical SMILES for 2-(4-chloro-2-pyridinyl)propan-2-ol;ethyl 4-chloropyridine-2-carboxylate is CC(C)(O)c1cc(Cl)ccn1.CCOC(=O)c1cc(Cl)ccn1.
What is the InChIKey of 2-(4-chloro-2-pyridinyl)propan-2-ol;ethyl 4-chloropyridine-2-carboxylate?
The InChIKey is BBOADJTZCZXXGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8ClNO2.C8H10ClNO/c1-2-12-8(11)7-5-6(9)3-4-10-7;1-8(2,11)7-5-6(9)3-4-10-7/h3-5H,2H2,1H3;3-5,11H,1-2H3.
What are the key properties of 2-(4-chloro-2-pyridinyl)propan-2-ol;ethyl 4-chloropyridine-2-carboxylate?
2-(4-chloro-2-pyridinyl)propan-2-ol;ethyl 4-chloropyridine-2-carboxylate has a molecular weight of 357.24 g/mol, XLogP of 3.87, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-chloro-2-pyridinyl)propan-2-ol;ethyl 4-chloropyridine-2-carboxylate is sourced from PubChem (CID 157297902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).