About 5-[(2-chlorocyclohexa-2,4-dien-1-yl)methoxy]-1-(1-cyclohexylethyl)-3-propylpyrazole
5-[(2-chlorocyclohexa-2,4-dien-1-yl)methoxy]-1-(1-cyclohexylethyl)-3-propylpyrazole (PubChem CID 157297935) has the molecular formula C21H31ClN2O
and a molecular weight of 362.95 g/mol. Its IUPAC name is 5-[(2-chlorocyclohexa-2,4-dien-1-yl)methoxy]-1-(1-cyclohexylethyl)-3-propylpyrazole.
Molecular Properties
| Compound Name | 5-[(2-chlorocyclohexa-2,4-dien-1-yl)methoxy]-1-(1-cyclohexylethyl)-3-propylpyrazole |
| PubChem CID | 157297935 |
| Molecular Formula | C21H31ClN2O |
| Molecular Weight | 362.95 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | 5-[(2-chlorocyclohexa-2,4-dien-1-yl)methoxy]-1-(1-cyclohexylethyl)-3-propylpyrazole |
| SMILES | CCCc1cc(OCC2CC=CC=C2Cl)n(C(C)C2CCCCC2)n1 |
| InChI | InChI=1S/C21H31ClN2O/c1-3-9-19-14-21(25-15-18-12-7-8-13-20(18)22)24(23-19)16(2)17-10-5-4-6-11-17/h7-8,13-14,16-18H,3-6,9-12,15H2,1-2H3 |
| InChIKey | BBODOKXFSRORRO-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 362.95 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-[(2-chlorocyclohexa-2,4-dien-1-yl)methoxy]-1-(1-cyclohexylethyl)-3-propylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(2-chlorocyclohexa-2,4-dien-1-yl)methoxy]-1-(1-cyclohexylethyl)-3-propylpyrazole?
The IUPAC name of 5-[(2-chlorocyclohexa-2,4-dien-1-yl)methoxy]-1-(1-cyclohexylethyl)-3-propylpyrazole (CID 157297935) is 5-[(2-chlorocyclohexa-2,4-dien-1-yl)methoxy]-1-(1-cyclohexylethyl)-3-propylpyrazole.
What is the SMILES notation for 5-[(2-chlorocyclohexa-2,4-dien-1-yl)methoxy]-1-(1-cyclohexylethyl)-3-propylpyrazole?
The canonical SMILES for 5-[(2-chlorocyclohexa-2,4-dien-1-yl)methoxy]-1-(1-cyclohexylethyl)-3-propylpyrazole is CCCc1cc(OCC2CC=CC=C2Cl)n(C(C)C2CCCCC2)n1.
What is the InChIKey of 5-[(2-chlorocyclohexa-2,4-dien-1-yl)methoxy]-1-(1-cyclohexylethyl)-3-propylpyrazole?
The InChIKey is BBODOKXFSRORRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H31ClN2O/c1-3-9-19-14-21(25-15-18-12-7-8-13-20(18)22)24(23-19)16(2)17-10-5-4-6-11-17/h7-8,13-14,16-18H,3-6,9-12,15H2,1-2H3.
What are the key properties of 5-[(2-chlorocyclohexa-2,4-dien-1-yl)methoxy]-1-(1-cyclohexylethyl)-3-propylpyrazole?
5-[(2-chlorocyclohexa-2,4-dien-1-yl)methoxy]-1-(1-cyclohexylethyl)-3-propylpyrazole has a molecular weight of 362.95 g/mol, XLogP of 6.05, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(2-chlorocyclohexa-2,4-dien-1-yl)methoxy]-1-(1-cyclohexylethyl)-3-propylpyrazole is sourced from PubChem (CID 157297935), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).