About 1,1-difluoropropyl hydrogen carbonate;2-fluoroethyl fluoromethyl carbonate
1,1-difluoropropyl hydrogen carbonate;2-fluoroethyl fluoromethyl carbonate (PubChem CID 157297990) has the molecular formula C8H12F4O6
and a molecular weight of 280.17 g/mol. Its IUPAC name is 1,1-difluoropropyl hydrogen carbonate;2-fluoroethyl fluoromethyl carbonate.
Molecular Properties
| Compound Name | 1,1-difluoropropyl hydrogen carbonate;2-fluoroethyl fluoromethyl carbonate |
| PubChem CID | 157297990 |
| Molecular Formula | C8H12F4O6 |
| Molecular Weight | 280.17 g/mol |
| Exact Mass | 280.06 |
| IUPAC Name | 1,1-difluoropropyl hydrogen carbonate;2-fluoroethyl fluoromethyl carbonate |
| SMILES | CCC(F)(F)OC(=O)O.O=C(OCF)OCCF |
| InChI | InChI=1S/2C4H6F2O3/c5-1-2-8-4(7)9-3-6;1-2-4(5,6)9-3(7)8/h1-3H2;2H2,1H3,(H,7,8) |
| InChIKey | BBOJKQMFVIFGEF-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.17 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1,1-difluoropropyl hydrogen carbonate;2-fluoroethyl fluoromethyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-difluoropropyl hydrogen carbonate;2-fluoroethyl fluoromethyl carbonate?
The IUPAC name of 1,1-difluoropropyl hydrogen carbonate;2-fluoroethyl fluoromethyl carbonate (CID 157297990) is 1,1-difluoropropyl hydrogen carbonate;2-fluoroethyl fluoromethyl carbonate.
What is the SMILES notation for 1,1-difluoropropyl hydrogen carbonate;2-fluoroethyl fluoromethyl carbonate?
The canonical SMILES for 1,1-difluoropropyl hydrogen carbonate;2-fluoroethyl fluoromethyl carbonate is CCC(F)(F)OC(=O)O.O=C(OCF)OCCF.
What is the InChIKey of 1,1-difluoropropyl hydrogen carbonate;2-fluoroethyl fluoromethyl carbonate?
The InChIKey is BBOJKQMFVIFGEF-UHFFFAOYSA-N. The full InChI is InChI=1S/2C4H6F2O3/c5-1-2-8-4(7)9-3-6;1-2-4(5,6)9-3(7)8/h1-3H2;2H2,1H3,(H,7,8).
What are the key properties of 1,1-difluoropropyl hydrogen carbonate;2-fluoroethyl fluoromethyl carbonate?
1,1-difluoropropyl hydrogen carbonate;2-fluoroethyl fluoromethyl carbonate has a molecular weight of 280.17 g/mol, XLogP of 2.72, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-difluoropropyl hydrogen carbonate;2-fluoroethyl fluoromethyl carbonate is sourced from PubChem (CID 157297990), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).