C9H8F4N2O2 — CID 157299113
1-methyl-2-oxo-6-(1,1,2,2-tetrafluoroethyl)pyridine-3-carboxamide (PubChem CID 157299113) has the molecular formula C9H8F4N2O2 and a molecular weight of 252.17 g/mol. Its IUPAC name is 1-methyl-2-oxo-6-(1,1,2,2-tetrafluoroethyl)pyridine-3-carboxamide.
| Compound Name | 1-methyl-2-oxo-6-(1,1,2,2-tetrafluoroethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 157299113 |
| Molecular Formula | C9H8F4N2O2 |
| Molecular Weight | 252.17 g/mol |
| Exact Mass | 252.05 |
| IUPAC Name | 1-methyl-2-oxo-6-(1,1,2,2-tetrafluoroethyl)pyridine-3-carboxamide |
| SMILES | Cn1c(C(F)(F)C(F)F)ccc(C(N)=O)c1=O |
| InChI | InChI=1S/C9H8F4N2O2/c1-15-5(9(12,13)8(10)11)3-2-4(6(14)16)7(15)17/h2-3,8H,1H3,(H2,14,16) |
| InChIKey | BBRMDPOMWVLILH-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 65.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.17 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|