C24H32F2N4O — CID 15729913
1-cyclohexyl-1-(4-fluorophenyl)-4-[4-(5-fluoropyrimidin-2-yl)piperazin-1-yl]butan-1-ol (PubChem CID 15729913) has the molecular formula C24H32F2N4O and a molecular weight of 430.54 g/mol. Its IUPAC name is 1-cyclohexyl-1-(4-fluorophenyl)-4-[4-(5-fluoropyrimidin-2-yl)piperazin-1-yl]butan-1-ol.
| Compound Name | 1-cyclohexyl-1-(4-fluorophenyl)-4-[4-(5-fluoropyrimidin-2-yl)piperazin-1-yl]butan-1-ol |
|---|---|
| PubChem CID | 15729913 |
| Molecular Formula | C24H32F2N4O |
| Molecular Weight | 430.54 g/mol |
| Exact Mass | 430.25 |
| IUPAC Name | 1-cyclohexyl-1-(4-fluorophenyl)-4-[4-(5-fluoropyrimidin-2-yl)piperazin-1-yl]butan-1-ol |
| SMILES | OC(CCCN1CCN(c2ncc(F)cn2)CC1)(c1ccc(F)cc1)C1CCCCC1 |
| InChI | InChI=1S/C24H32F2N4O/c25-21-9-7-20(8-10-21)24(31,19-5-2-1-3-6-19)11-4-12-29-13-15-30(16-14-29)23-27-17-22(26)18-28-23/h7-10,17-19,31H,1-6,11-16H2 |
| InChIKey | DFJIEXYUBMAVDS-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.54 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |