About sodium;1-phenylpyrazolidin-3-one;bromide
sodium;1-phenylpyrazolidin-3-one;bromide (PubChem CID 157299139) has the molecular formula C9H10BrN2NaO
and a molecular weight of 265.09 g/mol. Its IUPAC name is sodium;1-phenylpyrazolidin-3-one;bromide.
Molecular Properties
| Compound Name | sodium;1-phenylpyrazolidin-3-one;bromide |
| PubChem CID | 157299139 |
| Molecular Formula | C9H10BrN2NaO |
| Molecular Weight | 265.09 g/mol |
| Exact Mass | 263.99 |
| IUPAC Name | sodium;1-phenylpyrazolidin-3-one;bromide |
| SMILES | O=C1CCN(c2ccccc2)N1.[Br-].[Na+] |
| InChI | InChI=1S/C9H10N2O.BrH.Na/c12-9-6-7-11(10-9)8-4-2-1-3-5-8;;/h1-5H,6-7H2,(H,10,12);1H;/q;;+1/p-1 |
| InChIKey | BBROPJCKFRLLOS-UHFFFAOYSA-M |
| XLogP | -5.06 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.09 |
| LogP ≤ 5 | -5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze sodium;1-phenylpyrazolidin-3-one;bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;1-phenylpyrazolidin-3-one;bromide?
The IUPAC name of sodium;1-phenylpyrazolidin-3-one;bromide (CID 157299139) is sodium;1-phenylpyrazolidin-3-one;bromide.
What is the SMILES notation for sodium;1-phenylpyrazolidin-3-one;bromide?
The canonical SMILES for sodium;1-phenylpyrazolidin-3-one;bromide is O=C1CCN(c2ccccc2)N1.[Br-].[Na+].
What is the InChIKey of sodium;1-phenylpyrazolidin-3-one;bromide?
The InChIKey is BBROPJCKFRLLOS-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H10N2O.BrH.Na/c12-9-6-7-11(10-9)8-4-2-1-3-5-8;;/h1-5H,6-7H2,(H,10,12);1H;/q;;+1/p-1.
What are the key properties of sodium;1-phenylpyrazolidin-3-one;bromide?
sodium;1-phenylpyrazolidin-3-one;bromide has a molecular weight of 265.09 g/mol, XLogP of -5.06, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;1-phenylpyrazolidin-3-one;bromide is sourced from PubChem (CID 157299139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).