About 6-ethyl-2-methylsulfanylpyrido[4,3-d]pyrimidin-5-one;iodoethane
6-ethyl-2-methylsulfanylpyrido[4,3-d]pyrimidin-5-one;iodoethane (PubChem CID 157299178) has the molecular formula C12H16IN3OS
and a molecular weight of 377.25 g/mol. Its IUPAC name is 6-ethyl-2-methylsulfanylpyrido[4,3-d]pyrimidin-5-one;iodoethane.
Molecular Properties
| Compound Name | 6-ethyl-2-methylsulfanylpyrido[4,3-d]pyrimidin-5-one;iodoethane |
| PubChem CID | 157299178 |
| Molecular Formula | C12H16IN3OS |
| Molecular Weight | 377.25 g/mol |
| Exact Mass | 377.01 |
| IUPAC Name | 6-ethyl-2-methylsulfanylpyrido[4,3-d]pyrimidin-5-one;iodoethane |
| SMILES | CCI.CCn1ccc2nc(SC)ncc2c1=O |
| InChI | InChI=1S/C10H11N3OS.C2H5I/c1-3-13-5-4-8-7(9(13)14)6-11-10(12-8)15-2;1-2-3/h4-6H,3H2,1-2H3;2H2,1H3 |
| InChIKey | BBRRWADLDQSHDD-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.25 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 6-ethyl-2-methylsulfanylpyrido[4,3-d]pyrimidin-5-one;iodoethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethyl-2-methylsulfanylpyrido[4,3-d]pyrimidin-5-one;iodoethane?
The IUPAC name of 6-ethyl-2-methylsulfanylpyrido[4,3-d]pyrimidin-5-one;iodoethane (CID 157299178) is 6-ethyl-2-methylsulfanylpyrido[4,3-d]pyrimidin-5-one;iodoethane.
What is the SMILES notation for 6-ethyl-2-methylsulfanylpyrido[4,3-d]pyrimidin-5-one;iodoethane?
The canonical SMILES for 6-ethyl-2-methylsulfanylpyrido[4,3-d]pyrimidin-5-one;iodoethane is CCI.CCn1ccc2nc(SC)ncc2c1=O.
What is the InChIKey of 6-ethyl-2-methylsulfanylpyrido[4,3-d]pyrimidin-5-one;iodoethane?
The InChIKey is BBRRWADLDQSHDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N3OS.C2H5I/c1-3-13-5-4-8-7(9(13)14)6-11-10(12-8)15-2;1-2-3/h4-6H,3H2,1-2H3;2H2,1H3.
What are the key properties of 6-ethyl-2-methylsulfanylpyrido[4,3-d]pyrimidin-5-one;iodoethane?
6-ethyl-2-methylsulfanylpyrido[4,3-d]pyrimidin-5-one;iodoethane has a molecular weight of 377.25 g/mol, XLogP of 2.97, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethyl-2-methylsulfanylpyrido[4,3-d]pyrimidin-5-one;iodoethane is sourced from PubChem (CID 157299178), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).