About 1,2-dimethylimidazole;1,4-dimethylimidazole;1-methylpyrrole
1,2-dimethylimidazole;1,4-dimethylimidazole;1-methylpyrrole (PubChem CID 157299568) has the molecular formula C15H23N5
and a molecular weight of 273.38 g/mol. Its IUPAC name is 1,2-dimethylimidazole;1,4-dimethylimidazole;1-methylpyrrole.
Molecular Properties
| Compound Name | 1,2-dimethylimidazole;1,4-dimethylimidazole;1-methylpyrrole |
| PubChem CID | 157299568 |
| Molecular Formula | C15H23N5 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.20 |
| IUPAC Name | 1,2-dimethylimidazole;1,4-dimethylimidazole;1-methylpyrrole |
| SMILES | Cc1cn(C)cn1.Cc1nccn1C.Cn1cccc1 |
| InChI | InChI=1S/2C5H8N2.C5H7N/c1-5-3-7(2)4-6-5;1-5-6-3-4-7(5)2;1-6-4-2-3-5-6/h2*3-4H,1-2H3;2-5H,1H3 |
| InChIKey | BBSXRYFCBLQNGR-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 40.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1,2-dimethylimidazole;1,4-dimethylimidazole;1-methylpyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dimethylimidazole;1,4-dimethylimidazole;1-methylpyrrole?
The IUPAC name of 1,2-dimethylimidazole;1,4-dimethylimidazole;1-methylpyrrole (CID 157299568) is 1,2-dimethylimidazole;1,4-dimethylimidazole;1-methylpyrrole.
What is the SMILES notation for 1,2-dimethylimidazole;1,4-dimethylimidazole;1-methylpyrrole?
The canonical SMILES for 1,2-dimethylimidazole;1,4-dimethylimidazole;1-methylpyrrole is Cc1cn(C)cn1.Cc1nccn1C.Cn1cccc1.
What is the InChIKey of 1,2-dimethylimidazole;1,4-dimethylimidazole;1-methylpyrrole?
The InChIKey is BBSXRYFCBLQNGR-UHFFFAOYSA-N. The full InChI is InChI=1S/2C5H8N2.C5H7N/c1-5-3-7(2)4-6-5;1-5-6-3-4-7(5)2;1-6-4-2-3-5-6/h2*3-4H,1-2H3;2-5H,1H3.
What are the key properties of 1,2-dimethylimidazole;1,4-dimethylimidazole;1-methylpyrrole?
1,2-dimethylimidazole;1,4-dimethylimidazole;1-methylpyrrole has a molecular weight of 273.38 g/mol, XLogP of 2.48, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dimethylimidazole;1,4-dimethylimidazole;1-methylpyrrole is sourced from PubChem (CID 157299568), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).