C14H17N7O — CID 15729970
5-N-cyclohexyl-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazine-5,7-diamine (PubChem CID 15729970) has the molecular formula C14H17N7O and a molecular weight of 299.34 g/mol. Its IUPAC name is 5-N-cyclohexyl-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazine-5,7-diamine.
| Compound Name | 5-N-cyclohexyl-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazine-5,7-diamine |
|---|---|
| PubChem CID | 15729970 |
| Molecular Formula | C14H17N7O |
| Molecular Weight | 299.34 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | 5-N-cyclohexyl-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazine-5,7-diamine |
| SMILES | Nc1nc(NC2CCCCC2)nc2nc(-c3ccco3)nn12 |
| InChI | InChI=1S/C14H17N7O/c15-12-18-13(16-9-5-2-1-3-6-9)19-14-17-11(20-21(12)14)10-7-4-8-22-10/h4,7-9H,1-3,5-6H2,(H3,15,16,17,18,19,20) |
| InChIKey | KTRATDJORYAFKA-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 107.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.34 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |