About 2,4-dimethoxyquinazoline;hydrate;hydrochloride
2,4-dimethoxyquinazoline;hydrate;hydrochloride (PubChem CID 157300135) has the molecular formula C10H13ClN2O3
and a molecular weight of 244.68 g/mol. Its IUPAC name is 2,4-dimethoxyquinazoline;hydrate;hydrochloride.
Molecular Properties
| Compound Name | 2,4-dimethoxyquinazoline;hydrate;hydrochloride |
| PubChem CID | 157300135 |
| Molecular Formula | C10H13ClN2O3 |
| Molecular Weight | 244.68 g/mol |
| Exact Mass | 244.06 |
| IUPAC Name | 2,4-dimethoxyquinazoline;hydrate;hydrochloride |
| SMILES | COc1nc(OC)c2ccccc2n1.Cl.O |
| InChI | InChI=1S/C10H10N2O2.ClH.H2O/c1-13-9-7-5-3-4-6-8(7)11-10(12-9)14-2;;/h3-6H,1-2H3;1H;1H2 |
| InChIKey | BBUMHNGYUDGBRV-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 75.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.68 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,4-dimethoxyquinazoline;hydrate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dimethoxyquinazoline;hydrate;hydrochloride?
The IUPAC name of 2,4-dimethoxyquinazoline;hydrate;hydrochloride (CID 157300135) is 2,4-dimethoxyquinazoline;hydrate;hydrochloride.
What is the SMILES notation for 2,4-dimethoxyquinazoline;hydrate;hydrochloride?
The canonical SMILES for 2,4-dimethoxyquinazoline;hydrate;hydrochloride is COc1nc(OC)c2ccccc2n1.Cl.O.
What is the InChIKey of 2,4-dimethoxyquinazoline;hydrate;hydrochloride?
The InChIKey is BBUMHNGYUDGBRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2O2.ClH.H2O/c1-13-9-7-5-3-4-6-8(7)11-10(12-9)14-2;;/h3-6H,1-2H3;1H;1H2.
What are the key properties of 2,4-dimethoxyquinazoline;hydrate;hydrochloride?
2,4-dimethoxyquinazoline;hydrate;hydrochloride has a molecular weight of 244.68 g/mol, XLogP of 1.24, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dimethoxyquinazoline;hydrate;hydrochloride is sourced from PubChem (CID 157300135), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).