C23H27N7O3 — CID 15730016
tert-butyl 3-[4-[2-[[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]amino]ethyl]phenyl]propanoate (PubChem CID 15730016) has the molecular formula C23H27N7O3 and a molecular weight of 449.52 g/mol. Its IUPAC name is tert-butyl 3-[4-[2-[[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]amino]ethyl]phenyl]propanoate.
| Compound Name | tert-butyl 3-[4-[2-[[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]amino]ethyl]phenyl]propanoate |
|---|---|
| PubChem CID | 15730016 |
| Molecular Formula | C23H27N7O3 |
| Molecular Weight | 449.52 g/mol |
| Exact Mass | 449.22 |
| IUPAC Name | tert-butyl 3-[4-[2-[[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]amino]ethyl]phenyl]propanoate |
| SMILES | CC(C)(C)OC(=O)CCc1ccc(CCNc2nc(N)n3nc(-c4ccco4)nc3n2)cc1 |
| InChI | InChI=1S/C23H27N7O3/c1-23(2,3)33-18(31)11-10-15-6-8-16(9-7-15)12-13-25-21-27-20(24)30-22(28-21)26-19(29-30)17-5-4-14-32-17/h4-9,14H,10-13H2,1-3H3,(H3,24,25,26,27,28,29) |
| InChIKey | CBFWVAZESKIOGO-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 133.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.52 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |