C33H31F3NO2+ — CID 157301482
9,10-dimethyl-2-(1-phenylethoxymethyl)-7-[(2,2,2-trifluoro-1-phenylethoxy)methyl]acridin-10-ium (PubChem CID 157301482) has the molecular formula C33H31F3NO2+ and a molecular weight of 530.61 g/mol. Its IUPAC name is 9,10-dimethyl-2-(1-phenylethoxymethyl)-7-[(2,2,2-trifluoro-1-phenylethoxy)methyl]acridin-10-ium.
| Compound Name | 9,10-dimethyl-2-(1-phenylethoxymethyl)-7-[(2,2,2-trifluoro-1-phenylethoxy)methyl]acridin-10-ium |
|---|---|
| PubChem CID | 157301482 |
| Molecular Formula | C33H31F3NO2+ |
| Molecular Weight | 530.61 g/mol |
| Exact Mass | 530.23 |
| IUPAC Name | 9,10-dimethyl-2-(1-phenylethoxymethyl)-7-[(2,2,2-trifluoro-1-phenylethoxy)methyl]acridin-10-ium |
| SMILES | Cc1c2cc(COC(C)c3ccccc3)ccc2[n+](C)c2ccc(COC(c3ccccc3)C(F)(F)F)cc12 |
| InChI | InChI=1S/C33H31F3NO2/c1-22-28-18-24(20-38-23(2)26-10-6-4-7-11-26)14-16-30(28)37(3)31-17-15-25(19-29(22)31)21-39-32(33(34,35)36)27-12-8-5-9-13-27/h4-19,23,32H,20-21H2,1-3H3/q+1 |
| InChIKey | OKHFHUCXTUJRTE-UHFFFAOYSA-N |
| XLogP | 8.22 |
| TPSA | 22.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.61 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|