C34H28F2N4O2 — CID 157301613
3-[2-(5,7-difluoro-1H-indol-3-yl)-6-[[(2R,3R)-3-methyl-2-bicyclo[2.2.2]octanyl]amino]pyrimidin-4-yl]xanthen-9-one (PubChem CID 157301613) has the molecular formula C34H28F2N4O2 and a molecular weight of 562.62 g/mol. Its IUPAC name is 3-[2-(5,7-difluoro-1H-indol-3-yl)-6-[[(2R,3R)-3-methyl-2-bicyclo[2.2.2]octanyl]amino]pyrimidin-4-yl]xanthen-9-one.
| Compound Name | 3-[2-(5,7-difluoro-1H-indol-3-yl)-6-[[(2R,3R)-3-methyl-2-bicyclo[2.2.2]octanyl]amino]pyrimidin-4-yl]xanthen-9-one |
|---|---|
| PubChem CID | 157301613 |
| Molecular Formula | C34H28F2N4O2 |
| Molecular Weight | 562.62 g/mol |
| Exact Mass | 562.22 |
| IUPAC Name | 3-[2-(5,7-difluoro-1H-indol-3-yl)-6-[[(2R,3R)-3-methyl-2-bicyclo[2.2.2]octanyl]amino]pyrimidin-4-yl]xanthen-9-one |
| SMILES | C[C@@H]1C2CCC(CC2)[C@H]1Nc1cc(-c2ccc3c(=O)c4ccccc4oc3c2)nc(-c2c[nH]c3c(F)cc(F)cc23)n1 |
| InChI | InChI=1S/C34H28F2N4O2/c1-17-18-6-8-19(9-7-18)31(17)39-30-15-27(38-34(40-30)25-16-37-32-24(25)13-21(35)14-26(32)36)20-10-11-23-29(12-20)42-28-5-3-2-4-22(28)33(23)41/h2-5,10-19,31,37H,6-9H2,1H3,(H,38,39,40)/t17-,18?,19?,31+/m1/s1 |
| InChIKey | NMYIFVZKPJGIKN-XWRDYELXSA-N |
| XLogP | 8.07 |
| TPSA | 83.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.62 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|