C15H20ClNO — CID 157302692
(3S,5S,6R)-5-(2-chlorophenyl)-1-ethyl-3,6-dimethylpiperidin-2-one (PubChem CID 157302692) has the molecular formula C15H20ClNO and a molecular weight of 265.78 g/mol. Its IUPAC name is (3S,5S,6R)-5-(2-chlorophenyl)-1-ethyl-3,6-dimethylpiperidin-2-one.
| Compound Name | (3S,5S,6R)-5-(2-chlorophenyl)-1-ethyl-3,6-dimethylpiperidin-2-one |
|---|---|
| PubChem CID | 157302692 |
| Molecular Formula | C15H20ClNO |
| Molecular Weight | 265.78 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | (3S,5S,6R)-5-(2-chlorophenyl)-1-ethyl-3,6-dimethylpiperidin-2-one |
| SMILES | CCN1C(=O)[C@@H](C)C[C@@H](c2ccccc2Cl)[C@H]1C |
| InChI | InChI=1S/C15H20ClNO/c1-4-17-11(3)13(9-10(2)15(17)18)12-7-5-6-8-14(12)16/h5-8,10-11,13H,4,9H2,1-3H3/t10-,11+,13+/m0/s1 |
| InChIKey | WDTASFDVQOCRGX-DMDPSCGWSA-N |
| XLogP | 3.70 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.78 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |