C19H28O4 — CID 15730329
9,10-dihydroxyheptadec-1-en-11,13-diyn-8-yl acetate (PubChem CID 15730329) has the molecular formula C19H28O4 and a molecular weight of 320.43 g/mol. Its IUPAC name is 9,10-dihydroxyheptadec-1-en-11,13-diyn-8-yl acetate.
| Compound Name | 9,10-dihydroxyheptadec-1-en-11,13-diyn-8-yl acetate |
|---|---|
| PubChem CID | 15730329 |
| Molecular Formula | C19H28O4 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | 9,10-dihydroxyheptadec-1-en-11,13-diyn-8-yl acetate |
| SMILES | C=CCCCCCC(OC(C)=O)C(O)C(O)C#CC#CCCC |
| InChI | InChI=1S/C19H28O4/c1-4-6-8-10-12-14-17(21)19(22)18(23-16(3)20)15-13-11-9-7-5-2/h5,17-19,21-22H,2,4,6-7,9,11,13,15H2,1,3H3 |
| InChIKey | MLZOGDXJUCWBRY-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|