C27H27FN2O4S — CID 157304165
3-[2-[3-[2-(1-aminoethyl)-5-[2-(3-fluoro-4-pyridinyl)acetyl]phenyl]phenoxy]ethylsulfanyl]oxolan-2-one (PubChem CID 157304165) has the molecular formula C27H27FN2O4S and a molecular weight of 494.59 g/mol. Its IUPAC name is 3-[2-[3-[2-(1-aminoethyl)-5-[2-(3-fluoro-4-pyridinyl)acetyl]phenyl]phenoxy]ethylsulfanyl]oxolan-2-one.
| Compound Name | 3-[2-[3-[2-(1-aminoethyl)-5-[2-(3-fluoro-4-pyridinyl)acetyl]phenyl]phenoxy]ethylsulfanyl]oxolan-2-one |
|---|---|
| PubChem CID | 157304165 |
| Molecular Formula | C27H27FN2O4S |
| Molecular Weight | 494.59 g/mol |
| Exact Mass | 494.17 |
| IUPAC Name | 3-[2-[3-[2-(1-aminoethyl)-5-[2-(3-fluoro-4-pyridinyl)acetyl]phenyl]phenoxy]ethylsulfanyl]oxolan-2-one |
| SMILES | CC(N)c1ccc(C(=O)Cc2ccncc2F)cc1-c1cccc(OCCSC2CCOC2=O)c1 |
| InChI | InChI=1S/C27H27FN2O4S/c1-17(29)22-6-5-20(25(31)15-19-7-9-30-16-24(19)28)14-23(22)18-3-2-4-21(13-18)33-11-12-35-26-8-10-34-27(26)32/h2-7,9,13-14,16-17,26H,8,10-12,15,29H2,1H3 |
| InChIKey | BCGDTCQNZDOQEN-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 91.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.59 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|